C19H29ClN5O8P — CID 149203555
[2-[[(2R,3S,4R,5R)-5-[6-chloro-4-(cyclopentylamino)pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-4-hydroxybutan-2-yl]phosphonic acid (PubChem CID 149203555) has the molecular formula C19H29ClN5O8P and a molecular weight of 521.90 g/mol. Its IUPAC name is [2-[[(2R,3S,4R,5R)-5-[6-chloro-4-(cyclopentylamino)pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-4-hydroxybutan-2-yl]phosphonic acid.
| Compound Name | [2-[[(2R,3S,4R,5R)-5-[6-chloro-4-(cyclopentylamino)pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-4-hydroxybutan-2-yl]phosphonic acid |
|---|---|
| PubChem CID | 149203555 |
| Molecular Formula | C19H29ClN5O8P |
| Molecular Weight | 521.90 g/mol |
| Exact Mass | 521.14 |
| IUPAC Name | [2-[[(2R,3S,4R,5R)-5-[6-chloro-4-(cyclopentylamino)pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-4-hydroxybutan-2-yl]phosphonic acid |
| SMILES | CC(CCO)(OC[C@H]1O[C@@H](n2ncc3c(NC4CCCC4)nc(Cl)nc32)[C@H](O)[C@@H]1O)P(=O)(O)O |
| InChI | InChI=1S/C19H29ClN5O8P/c1-19(6-7-26,34(29,30)31)32-9-12-13(27)14(28)17(33-12)25-16-11(8-21-25)15(23-18(20)24-16)22-10-4-2-3-5-10/h8,10,12-14,17,26-28H,2-7,9H2,1H3,(H,22,23,24)(H2,29,30,31)/t12-,13-,14-,17-,19?/m1/s1 |
| InChIKey | XFDYBFPHJWEVAA-RXUYWNQFSA-N |
| XLogP | 0.75 |
| TPSA | 192.31 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.90 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|