C18H16N2O2 — CID 14920391
10-acetyl-11,12-dihydro-9H-isoquinolino[2,1-b][2,7]naphthyridin-8-one (PubChem CID 14920391) has the molecular formula C18H16N2O2 and a molecular weight of 292.34 g/mol. Its IUPAC name is 10-acetyl-11,12-dihydro-9H-isoquinolino[2,1-b][2,7]naphthyridin-8-one.
| Compound Name | 10-acetyl-11,12-dihydro-9H-isoquinolino[2,1-b][2,7]naphthyridin-8-one |
|---|---|
| PubChem CID | 14920391 |
| Molecular Formula | C18H16N2O2 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 10-acetyl-11,12-dihydro-9H-isoquinolino[2,1-b][2,7]naphthyridin-8-one |
| SMILES | CC(=O)N1CCc2cc3c4ccccc4ccn3c(=O)c2C1 |
| InChI | InChI=1S/C18H16N2O2/c1-12(21)19-8-6-14-10-17-15-5-3-2-4-13(15)7-9-20(17)18(22)16(14)11-19/h2-5,7,9-10H,6,8,11H2,1H3 |
| InChIKey | PHPUHYFEXPHUTB-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 41.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|