C26H24N4O4 — CID 1492042
6-hydroxy-N'-[(2-methoxyphenyl)methyl]-1-(2-methylphenyl)-2,4-dioxo-N-phenylpyrimidine-5-carboximidamide (PubChem CID 1492042) has the molecular formula C26H24N4O4 and a molecular weight of 456.50 g/mol. Its IUPAC name is 6-hydroxy-N'-[(2-methoxyphenyl)methyl]-1-(2-methylphenyl)-2,4-dioxo-N-phenylpyrimidine-5-carboximidamide.
| Compound Name | 6-hydroxy-N'-[(2-methoxyphenyl)methyl]-1-(2-methylphenyl)-2,4-dioxo-N-phenylpyrimidine-5-carboximidamide |
|---|---|
| PubChem CID | 1492042 |
| Molecular Formula | C26H24N4O4 |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | 6-hydroxy-N'-[(2-methoxyphenyl)methyl]-1-(2-methylphenyl)-2,4-dioxo-N-phenylpyrimidine-5-carboximidamide |
| SMILES | COc1ccccc1C/N=C(\Nc1ccccc1)c1c(O)n(-c2ccccc2C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C26H24N4O4/c1-17-10-6-8-14-20(17)30-25(32)22(24(31)29-26(30)33)23(28-19-12-4-3-5-13-19)27-16-18-11-7-9-15-21(18)34-2/h3-15,32H,16H2,1-2H3,(H,27,28)(H,29,31,33) |
| InChIKey | GXWQMKFGPWEIBQ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 108.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|