C20H20BrFN2O — CID 149204259
1-(6-bromo-5-fluoro-2-pyridinyl)-2-[4-(3,5-dimethylcyclohexen-1-yl)-3-pyridinyl]ethanone (PubChem CID 149204259) has the molecular formula C20H20BrFN2O and a molecular weight of 403.30 g/mol. Its IUPAC name is 1-(6-bromo-5-fluoro-2-pyridinyl)-2-[4-(3,5-dimethylcyclohexen-1-yl)-3-pyridinyl]ethanone.
| Compound Name | 1-(6-bromo-5-fluoro-2-pyridinyl)-2-[4-(3,5-dimethylcyclohexen-1-yl)-3-pyridinyl]ethanone |
|---|---|
| PubChem CID | 149204259 |
| Molecular Formula | C20H20BrFN2O |
| Molecular Weight | 403.30 g/mol |
| Exact Mass | 402.07 |
| IUPAC Name | 1-(6-bromo-5-fluoro-2-pyridinyl)-2-[4-(3,5-dimethylcyclohexen-1-yl)-3-pyridinyl]ethanone |
| SMILES | CC1C=C(c2ccncc2CC(=O)c2ccc(F)c(Br)n2)CC(C)C1 |
| InChI | InChI=1S/C20H20BrFN2O/c1-12-7-13(2)9-14(8-12)16-5-6-23-11-15(16)10-19(25)18-4-3-17(22)20(21)24-18/h3-6,8,11-13H,7,9-10H2,1-2H3 |
| InChIKey | XFHGGFHGEZGYNZ-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.30 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|