C24H23F2N5OS — CID 149204615
(4,4-difluoropiperidin-1-yl)-[4-(1H-isoindol-5-ylamino)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]methanone (PubChem CID 149204615) has the molecular formula C24H23F2N5OS and a molecular weight of 467.55 g/mol. Its IUPAC name is (4,4-difluoropiperidin-1-yl)-[4-(1H-isoindol-5-ylamino)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]methanone.
| Compound Name | (4,4-difluoropiperidin-1-yl)-[4-(1H-isoindol-5-ylamino)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]methanone |
|---|---|
| PubChem CID | 149204615 |
| Molecular Formula | C24H23F2N5OS |
| Molecular Weight | 467.55 g/mol |
| Exact Mass | 467.16 |
| IUPAC Name | (4,4-difluoropiperidin-1-yl)-[4-(1H-isoindol-5-ylamino)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]methanone |
| SMILES | O=C(C1CCc2c(sc3ncnc(Nc4ccc5c(c4)C=NC5)c23)C1)N1CCC(F)(F)CC1 |
| InChI | InChI=1S/C24H23F2N5OS/c25-24(26)5-7-31(8-6-24)23(32)14-2-4-18-19(10-14)33-22-20(18)21(28-13-29-22)30-17-3-1-15-11-27-12-16(15)9-17/h1,3,9,12-14H,2,4-8,10-11H2,(H,28,29,30) |
| InChIKey | XFIZSXXVNANNOP-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 70.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.55 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |