C34H36 — CID 14921005
5,11-bis(2,4,6-trimethylphenyl)tricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaene (PubChem CID 14921005) has the molecular formula C34H36 and a molecular weight of 444.66 g/mol. Its IUPAC name is 5,11-bis(2,4,6-trimethylphenyl)tricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaene.
| Compound Name | 5,11-bis(2,4,6-trimethylphenyl)tricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaene |
|---|---|
| PubChem CID | 14921005 |
| Molecular Formula | C34H36 |
| Molecular Weight | 444.66 g/mol |
| Exact Mass | 444.28 |
| IUPAC Name | 5,11-bis(2,4,6-trimethylphenyl)tricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaene |
| SMILES | Cc1cc(C)c(-c2cc3ccc2CCc2ccc(c(-c4c(C)cc(C)cc4C)c2)CC3)c(C)c1 |
| InChI | InChI=1S/C34H36/c1-21-15-23(3)33(24(4)16-21)31-19-27-7-11-29(31)13-9-28-8-12-30(14-10-27)32(20-28)34-25(5)17-22(2)18-26(34)6/h7-8,11-12,15-20H,9-10,13-14H2,1-6H3 |
| InChIKey | RDEAWDMLIWIYLB-UHFFFAOYSA-N |
| XLogP | 8.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.66 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |