C16H14F6O6 — CID 149212187
1,1,1,3,3,3-hexafluoropropan-2-yl 1-(2-methylprop-2-enoyloxy)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-6-carboxylate (PubChem CID 149212187) has the molecular formula C16H14F6O6 and a molecular weight of 416.27 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 1-(2-methylprop-2-enoyloxy)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-6-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 1-(2-methylprop-2-enoyloxy)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-6-carboxylate |
|---|---|
| PubChem CID | 149212187 |
| Molecular Formula | C16H14F6O6 |
| Molecular Weight | 416.27 g/mol |
| Exact Mass | 416.07 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 1-(2-methylprop-2-enoyloxy)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-6-carboxylate |
| SMILES | C=C(C)C(=O)OC12CC3OC(=O)C(C(=O)OC(C(F)(F)F)C(F)(F)F)(C1)C3C2 |
| InChI | InChI=1S/C16H14F6O6/c1-6(2)9(23)28-13-3-7-8(4-13)26-11(24)14(7,5-13)12(25)27-10(15(17,18)19)16(20,21)22/h7-8,10H,1,3-5H2,2H3 |
| InChIKey | XGUMNPWCOJZOFM-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.27 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|