About 5-fluoro-2,4-dimethylpyridazin-3-one
5-fluoro-2,4-dimethylpyridazin-3-one (PubChem CID 149220971) has the molecular formula C6H7FN2O
and a molecular weight of 142.13 g/mol. Its IUPAC name is 5-fluoro-2,4-dimethylpyridazin-3-one.
Molecular Properties
| Compound Name | 5-fluoro-2,4-dimethylpyridazin-3-one |
| PubChem CID | 149220971 |
| Molecular Formula | C6H7FN2O |
| Molecular Weight | 142.13 g/mol |
| Exact Mass | 142.05 |
| IUPAC Name | 5-fluoro-2,4-dimethylpyridazin-3-one |
| SMILES | Cc1c(F)cnn(C)c1=O |
| InChI | InChI=1S/C6H7FN2O/c1-4-5(7)3-8-9(2)6(4)10/h3H,1-2H3 |
| InChIKey | XILGRCYRHKETAR-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.13 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-fluoro-2,4-dimethylpyridazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-2,4-dimethylpyridazin-3-one?
The IUPAC name of 5-fluoro-2,4-dimethylpyridazin-3-one (CID 149220971) is 5-fluoro-2,4-dimethylpyridazin-3-one.
What is the SMILES notation for 5-fluoro-2,4-dimethylpyridazin-3-one?
The canonical SMILES for 5-fluoro-2,4-dimethylpyridazin-3-one is Cc1c(F)cnn(C)c1=O.
What is the InChIKey of 5-fluoro-2,4-dimethylpyridazin-3-one?
The InChIKey is XILGRCYRHKETAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7FN2O/c1-4-5(7)3-8-9(2)6(4)10/h3H,1-2H3.
What are the key properties of 5-fluoro-2,4-dimethylpyridazin-3-one?
5-fluoro-2,4-dimethylpyridazin-3-one has a molecular weight of 142.13 g/mol, XLogP of 0.23, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-2,4-dimethylpyridazin-3-one is sourced from PubChem (CID 149220971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).