C12H15F6IO — CID 149222725
1,1,1,3,3,3-hexafluoro-2-[(6-iodo-5-methyl-2-bicyclo[2.2.1]heptanyl)methyl]propan-2-ol (PubChem CID 149222725) has the molecular formula C12H15F6IO and a molecular weight of 416.14 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-[(6-iodo-5-methyl-2-bicyclo[2.2.1]heptanyl)methyl]propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-[(6-iodo-5-methyl-2-bicyclo[2.2.1]heptanyl)methyl]propan-2-ol |
|---|---|
| PubChem CID | 149222725 |
| Molecular Formula | C12H15F6IO |
| Molecular Weight | 416.14 g/mol |
| Exact Mass | 416.01 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-[(6-iodo-5-methyl-2-bicyclo[2.2.1]heptanyl)methyl]propan-2-ol |
| SMILES | CC1C2CC(CC(O)(C(F)(F)F)C(F)(F)F)C(C2)C1I |
| InChI | InChI=1S/C12H15F6IO/c1-5-6-2-7(8(3-6)9(5)19)4-10(20,11(13,14)15)12(16,17)18/h5-9,20H,2-4H2,1H3 |
| InChIKey | XITLKHIWGDNLDU-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.14 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|