C34H41N3O4 — CID 149222742
N-(5,5-dimethyl-3-oxo-4-phenylhexyl)-N'-[[(3-methyl-2-phenylbutanoyl)amino]methyl]octa-3,5-diynediamide (PubChem CID 149222742) has the molecular formula C34H41N3O4 and a molecular weight of 555.72 g/mol. Its IUPAC name is N-(5,5-dimethyl-3-oxo-4-phenylhexyl)-N'-[[(3-methyl-2-phenylbutanoyl)amino]methyl]octa-3,5-diynediamide.
| Compound Name | N-(5,5-dimethyl-3-oxo-4-phenylhexyl)-N'-[[(3-methyl-2-phenylbutanoyl)amino]methyl]octa-3,5-diynediamide |
|---|---|
| PubChem CID | 149222742 |
| Molecular Formula | C34H41N3O4 |
| Molecular Weight | 555.72 g/mol |
| Exact Mass | 555.31 |
| IUPAC Name | N-(5,5-dimethyl-3-oxo-4-phenylhexyl)-N'-[[(3-methyl-2-phenylbutanoyl)amino]methyl]octa-3,5-diynediamide |
| SMILES | CC(C)C(C(=O)NCNC(=O)CC#CC#CCC(=O)NCCC(=O)C(c1ccccc1)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C34H41N3O4/c1-25(2)31(26-16-10-8-11-17-26)33(41)37-24-36-30(40)21-15-7-6-14-20-29(39)35-23-22-28(38)32(34(3,4)5)27-18-12-9-13-19-27/h8-13,16-19,25,31-32H,20-24H2,1-5H3,(H,35,39)(H,36,40)(H,37,41) |
| InChIKey | XITNFJRLSGDHER-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.72 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|