C24H26N6O — CID 149223940
[(2R,3R)-2-[2-(3-isocyano-2-pyridinyl)ethyl]-3-methylpiperidin-1-yl]-[5-methyl-2-(triazol-2-yl)phenyl]methanone (PubChem CID 149223940) has the molecular formula C24H26N6O and a molecular weight of 414.51 g/mol. Its IUPAC name is [(2R,3R)-2-[2-(3-isocyano-2-pyridinyl)ethyl]-3-methylpiperidin-1-yl]-[5-methyl-2-(triazol-2-yl)phenyl]methanone.
| Compound Name | [(2R,3R)-2-[2-(3-isocyano-2-pyridinyl)ethyl]-3-methylpiperidin-1-yl]-[5-methyl-2-(triazol-2-yl)phenyl]methanone |
|---|---|
| PubChem CID | 149223940 |
| Molecular Formula | C24H26N6O |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | [(2R,3R)-2-[2-(3-isocyano-2-pyridinyl)ethyl]-3-methylpiperidin-1-yl]-[5-methyl-2-(triazol-2-yl)phenyl]methanone |
| SMILES | [C-]#[N+]c1cccnc1CC[C@@H]1[C@H](C)CCCN1C(=O)c1cc(C)ccc1-n1nccn1 |
| InChI | InChI=1S/C24H26N6O/c1-17-8-10-23(30-27-13-14-28-30)19(16-17)24(31)29-15-5-6-18(2)22(29)11-9-21-20(25-3)7-4-12-26-21/h4,7-8,10,12-14,16,18,22H,5-6,9,11,15H2,1-2H3/t18-,22-/m1/s1 |
| InChIKey | XIZCKZRBJYLCRM-XMSQKQJNSA-N |
| XLogP | 4.40 |
| TPSA | 68.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|