C7H13O3PS2 — CID 14922859
S-(5,5-dimethyl-2-sulfanylidene-1,3,2lambda5-dioxaphosphinan-2-yl) ethanethioate (PubChem CID 14922859) has the molecular formula C7H13O3PS2 and a molecular weight of 240.29 g/mol. Its IUPAC name is S-(5,5-dimethyl-2-sulfanylidene-1,3,2lambda5-dioxaphosphinan-2-yl) ethanethioate.
| Compound Name | S-(5,5-dimethyl-2-sulfanylidene-1,3,2lambda5-dioxaphosphinan-2-yl) ethanethioate |
|---|---|
| PubChem CID | 14922859 |
| Molecular Formula | C7H13O3PS2 |
| Molecular Weight | 240.29 g/mol |
| Exact Mass | 240.00 |
| IUPAC Name | S-(5,5-dimethyl-2-sulfanylidene-1,3,2lambda5-dioxaphosphinan-2-yl) ethanethioate |
| SMILES | CC(=O)SP1(=S)OCC(C)(C)CO1 |
| InChI | InChI=1S/C7H13O3PS2/c1-6(8)13-11(12)9-4-7(2,3)5-10-11/h4-5H2,1-3H3 |
| InChIKey | FZLAPLBYYDQZCQ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.29 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|