C5HF9 — CID 14922984
(E)-1,1,2,3,4,4,5,5,5-nonafluoropent-2-ene (PubChem CID 14922984) has the molecular formula C5HF9 and a molecular weight of 232.04 g/mol. Its IUPAC name is (E)-1,1,2,3,4,4,5,5,5-nonafluoropent-2-ene.
| Compound Name | (E)-1,1,2,3,4,4,5,5,5-nonafluoropent-2-ene |
|---|---|
| PubChem CID | 14922984 |
| Molecular Formula | C5HF9 |
| Molecular Weight | 232.04 g/mol |
| Exact Mass | 231.99 |
| IUPAC Name | (E)-1,1,2,3,4,4,5,5,5-nonafluoropent-2-ene |
| SMILES | F/C(=C(/F)C(F)(F)C(F)(F)F)C(F)F |
| InChI | InChI=1S/C5HF9/c6-1(3(8)9)2(7)4(10,11)5(12,13)14/h3H/b2-1+ |
| InChIKey | CCHWGPNQONFKSV-OWOJBTEDSA-N |
| XLogP | 3.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.04 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|