C13H17FN5O13P3 — CID 149238050
[[(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-2-(fluoromethyl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 149238050) has the molecular formula C13H17FN5O13P3 and a molecular weight of 563.22 g/mol. Its IUPAC name is [[(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-2-(fluoromethyl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-2-(fluoromethyl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 149238050 |
| Molecular Formula | C13H17FN5O13P3 |
| Molecular Weight | 563.22 g/mol |
| Exact Mass | 563.00 |
| IUPAC Name | [[(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-2-(fluoromethyl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | N#C[C@@]1(c2ccc3c(N)ncnn23)O[C@](CF)(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C13H17FN5O13P3/c14-3-12(5-29-34(25,26)32-35(27,28)31-33(22,23)24)9(20)10(21)13(4-15,30-12)8-2-1-7-11(16)17-6-18-19(7)8/h1-2,6,9-10,20-21H,3,5H2,(H,25,26)(H,27,28)(H2,16,17,18)(H2,22,23,24)/t9-,10+,12+,13-/m0/s1 |
| InChIKey | XLPSXRCLKIDHAX-YGNMPJRFSA-N |
| XLogP | -1.17 |
| TPSA | 289.51 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.22 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|