C16H15NO2 — CID 149241121
(4-methylphenyl) (E)-3-(4-aminophenyl)prop-2-enoate (PubChem CID 149241121) has the molecular formula C16H15NO2 and a molecular weight of 253.30 g/mol. Its IUPAC name is (4-methylphenyl) (E)-3-(4-aminophenyl)prop-2-enoate.
| Compound Name | (4-methylphenyl) (E)-3-(4-aminophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 149241121 |
| Molecular Formula | C16H15NO2 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | (4-methylphenyl) (E)-3-(4-aminophenyl)prop-2-enoate |
| SMILES | Cc1ccc(OC(=O)/C=C/c2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C16H15NO2/c1-12-2-9-15(10-3-12)19-16(18)11-6-13-4-7-14(17)8-5-13/h2-11H,17H2,1H3/b11-6+ |
| InChIKey | XMEYCOREOQPMPK-IZZDOVSWSA-N |
| XLogP | 3.20 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|