C34H30F8N4 — CID 149246318
4-[5-[[2,4-bis(trifluoromethyl)phenyl]methyl]-2-(2,6-diethylphenyl)-6,6-dimethyl-4H-pyrrolo[3,4-c]pyrazol-3-yl]-5,7-difluoro-1H-indole (PubChem CID 149246318) has the molecular formula C34H30F8N4 and a molecular weight of 646.63 g/mol. Its IUPAC name is 4-[5-[[2,4-bis(trifluoromethyl)phenyl]methyl]-2-(2,6-diethylphenyl)-6,6-dimethyl-4H-pyrrolo[3,4-c]pyrazol-3-yl]-5,7-difluoro-1H-indole.
| Compound Name | 4-[5-[[2,4-bis(trifluoromethyl)phenyl]methyl]-2-(2,6-diethylphenyl)-6,6-dimethyl-4H-pyrrolo[3,4-c]pyrazol-3-yl]-5,7-difluoro-1H-indole |
|---|---|
| PubChem CID | 149246318 |
| Molecular Formula | C34H30F8N4 |
| Molecular Weight | 646.63 g/mol |
| Exact Mass | 646.23 |
| IUPAC Name | 4-[5-[[2,4-bis(trifluoromethyl)phenyl]methyl]-2-(2,6-diethylphenyl)-6,6-dimethyl-4H-pyrrolo[3,4-c]pyrazol-3-yl]-5,7-difluoro-1H-indole |
| SMILES | CCc1cccc(CC)c1-n1nc2c(c1-c1c(F)cc(F)c3[nH]ccc13)CN(Cc1ccc(C(F)(F)F)cc1C(F)(F)F)C2(C)C |
| InChI | InChI=1S/C34H30F8N4/c1-5-18-8-7-9-19(6-2)29(18)46-30(27-22-12-13-43-28(22)26(36)15-25(27)35)23-17-45(32(3,4)31(23)44-46)16-20-10-11-21(33(37,38)39)14-24(20)34(40,41)42/h7-15,43H,5-6,16-17H2,1-4H3 |
| InChIKey | XNEIFUDVQQUIOY-UHFFFAOYSA-N |
| XLogP | 9.71 |
| TPSA | 36.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.63 |
| LogP ≤ 5 | 9.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |