About 7'-acetyl-3'-cyclopropyl-8'-hydroxyspiro[cyclopentane-1,5'-indolizine]-6'-one
7'-acetyl-3'-cyclopropyl-8'-hydroxyspiro[cyclopentane-1,5'-indolizine]-6'-one (PubChem CID 149247367) has the molecular formula C17H19NO3
and a molecular weight of 285.34 g/mol. Its IUPAC name is 7'-acetyl-3'-cyclopropyl-8'-hydroxyspiro[cyclopentane-1,5'-indolizine]-6'-one.
Molecular Properties
| Compound Name | 7'-acetyl-3'-cyclopropyl-8'-hydroxyspiro[cyclopentane-1,5'-indolizine]-6'-one |
| PubChem CID | 149247367 |
| Molecular Formula | C17H19NO3 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | 7'-acetyl-3'-cyclopropyl-8'-hydroxyspiro[cyclopentane-1,5'-indolizine]-6'-one |
| SMILES | CC(=O)C1=C(O)c2ccc(C3CC3)n2C2(CCCC2)C1=O |
| InChI | InChI=1S/C17H19NO3/c1-10(19)14-15(20)13-7-6-12(11-4-5-11)18(13)17(16(14)21)8-2-3-9-17/h6-7,11,20H,2-5,8-9H2,1H3 |
| InChIKey | UBWFJPPIYACCNE-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze 7'-acetyl-3'-cyclopropyl-8'-hydroxyspiro[cyclopentane-1,5'-indolizine]-6'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7'-acetyl-3'-cyclopropyl-8'-hydroxyspiro[cyclopentane-1,5'-indolizine]-6'-one?
The IUPAC name of 7'-acetyl-3'-cyclopropyl-8'-hydroxyspiro[cyclopentane-1,5'-indolizine]-6'-one (CID 149247367) is 7'-acetyl-3'-cyclopropyl-8'-hydroxyspiro[cyclopentane-1,5'-indolizine]-6'-one.
What is the SMILES notation for 7'-acetyl-3'-cyclopropyl-8'-hydroxyspiro[cyclopentane-1,5'-indolizine]-6'-one?
The canonical SMILES for 7'-acetyl-3'-cyclopropyl-8'-hydroxyspiro[cyclopentane-1,5'-indolizine]-6'-one is CC(=O)C1=C(O)c2ccc(C3CC3)n2C2(CCCC2)C1=O.
What is the InChIKey of 7'-acetyl-3'-cyclopropyl-8'-hydroxyspiro[cyclopentane-1,5'-indolizine]-6'-one?
The InChIKey is UBWFJPPIYACCNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19NO3/c1-10(19)14-15(20)13-7-6-12(11-4-5-11)18(13)17(16(14)21)8-2-3-9-17/h6-7,11,20H,2-5,8-9H2,1H3.
What are the key properties of 7'-acetyl-3'-cyclopropyl-8'-hydroxyspiro[cyclopentane-1,5'-indolizine]-6'-one?
7'-acetyl-3'-cyclopropyl-8'-hydroxyspiro[cyclopentane-1,5'-indolizine]-6'-one has a molecular weight of 285.34 g/mol, XLogP of 3.08, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7'-acetyl-3'-cyclopropyl-8'-hydroxyspiro[cyclopentane-1,5'-indolizine]-6'-one is sourced from PubChem (CID 149247367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).