About methyl (1S)-1-hydroxy-2-[(1S,2S)-2-trimethylsilyloxycycloheptyl]oxycyclohex-2-ene-1-carboxylate
methyl (1S)-1-hydroxy-2-[(1S,2S)-2-trimethylsilyloxycycloheptyl]oxycyclohex-2-ene-1-carboxylate (PubChem CID 14924829) has the molecular formula C18H32O5Si
and a molecular weight of 356.54 g/mol. Its IUPAC name is methyl (1S)-1-hydroxy-2-[(1S,2S)-2-trimethylsilyloxycycloheptyl]oxycyclohex-2-ene-1-carboxylate.
Molecular Properties
| Compound Name | methyl (1S)-1-hydroxy-2-[(1S,2S)-2-trimethylsilyloxycycloheptyl]oxycyclohex-2-ene-1-carboxylate |
| PubChem CID | 14924829 |
| Molecular Formula | C18H32O5Si |
| Molecular Weight | 356.54 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | methyl (1S)-1-hydroxy-2-[(1S,2S)-2-trimethylsilyloxycycloheptyl]oxycyclohex-2-ene-1-carboxylate |
| SMILES | COC(=O)[C@]1(O)CCCC=C1O[C@H]1CCCCC[C@@H]1O[Si](C)(C)C |
| InChI | InChI=1S/C18H32O5Si/c1-21-17(19)18(20)13-9-8-12-16(18)22-14-10-6-5-7-11-15(14)23-24(2,3)4/h12,14-15,20H,5-11,13H2,1-4H3/t14-,15-,18-/m0/s1 |
| InChIKey | QSTYSPCRAAPVAK-MPGHIAIKSA-N |
| XLogP | 3.53 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.54 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze methyl (1S)-1-hydroxy-2-[(1S,2S)-2-trimethylsilyloxycycloheptyl]oxycyclohex-2-ene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (1S)-1-hydroxy-2-[(1S,2S)-2-trimethylsilyloxycycloheptyl]oxycyclohex-2-ene-1-carboxylate?
The IUPAC name of methyl (1S)-1-hydroxy-2-[(1S,2S)-2-trimethylsilyloxycycloheptyl]oxycyclohex-2-ene-1-carboxylate (CID 14924829) is methyl (1S)-1-hydroxy-2-[(1S,2S)-2-trimethylsilyloxycycloheptyl]oxycyclohex-2-ene-1-carboxylate.
What is the SMILES notation for methyl (1S)-1-hydroxy-2-[(1S,2S)-2-trimethylsilyloxycycloheptyl]oxycyclohex-2-ene-1-carboxylate?
The canonical SMILES for methyl (1S)-1-hydroxy-2-[(1S,2S)-2-trimethylsilyloxycycloheptyl]oxycyclohex-2-ene-1-carboxylate is COC(=O)[C@]1(O)CCCC=C1O[C@H]1CCCCC[C@@H]1O[Si](C)(C)C.
What is the InChIKey of methyl (1S)-1-hydroxy-2-[(1S,2S)-2-trimethylsilyloxycycloheptyl]oxycyclohex-2-ene-1-carboxylate?
The InChIKey is QSTYSPCRAAPVAK-MPGHIAIKSA-N. The full InChI is InChI=1S/C18H32O5Si/c1-21-17(19)18(20)13-9-8-12-16(18)22-14-10-6-5-7-11-15(14)23-24(2,3)4/h12,14-15,20H,5-11,13H2,1-4H3/t14-,15-,18-/m0/s1.
What are the key properties of methyl (1S)-1-hydroxy-2-[(1S,2S)-2-trimethylsilyloxycycloheptyl]oxycyclohex-2-ene-1-carboxylate?
methyl (1S)-1-hydroxy-2-[(1S,2S)-2-trimethylsilyloxycycloheptyl]oxycyclohex-2-ene-1-carboxylate has a molecular weight of 356.54 g/mol, XLogP of 3.53, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (1S)-1-hydroxy-2-[(1S,2S)-2-trimethylsilyloxycycloheptyl]oxycyclohex-2-ene-1-carboxylate is sourced from PubChem (CID 14924829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).