About methyl (1S)-1-hydroxy-2-[(1S,2S)-2-trimethylsilyloxycyclohexyl]oxycyclohex-2-ene-1-carboxylate
methyl (1S)-1-hydroxy-2-[(1S,2S)-2-trimethylsilyloxycyclohexyl]oxycyclohex-2-ene-1-carboxylate (PubChem CID 14924830) has the molecular formula C17H30O5Si
and a molecular weight of 342.51 g/mol. Its IUPAC name is methyl (1S)-1-hydroxy-2-[(1S,2S)-2-trimethylsilyloxycyclohexyl]oxycyclohex-2-ene-1-carboxylate.
Molecular Properties
| Compound Name | methyl (1S)-1-hydroxy-2-[(1S,2S)-2-trimethylsilyloxycyclohexyl]oxycyclohex-2-ene-1-carboxylate |
| PubChem CID | 14924830 |
| Molecular Formula | C17H30O5Si |
| Molecular Weight | 342.51 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | methyl (1S)-1-hydroxy-2-[(1S,2S)-2-trimethylsilyloxycyclohexyl]oxycyclohex-2-ene-1-carboxylate |
| SMILES | COC(=O)[C@]1(O)CCCC=C1O[C@H]1CCCC[C@@H]1O[Si](C)(C)C |
| InChI | InChI=1S/C17H30O5Si/c1-20-16(18)17(19)12-8-7-11-15(17)21-13-9-5-6-10-14(13)22-23(2,3)4/h11,13-14,19H,5-10,12H2,1-4H3/t13-,14-,17-/m0/s1 |
| InChIKey | WRNMLRIFINSYSY-ZQIUZPCESA-N |
| XLogP | 3.14 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.51 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze methyl (1S)-1-hydroxy-2-[(1S,2S)-2-trimethylsilyloxycyclohexyl]oxycyclohex-2-ene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (1S)-1-hydroxy-2-[(1S,2S)-2-trimethylsilyloxycyclohexyl]oxycyclohex-2-ene-1-carboxylate?
The IUPAC name of methyl (1S)-1-hydroxy-2-[(1S,2S)-2-trimethylsilyloxycyclohexyl]oxycyclohex-2-ene-1-carboxylate (CID 14924830) is methyl (1S)-1-hydroxy-2-[(1S,2S)-2-trimethylsilyloxycyclohexyl]oxycyclohex-2-ene-1-carboxylate.
What is the SMILES notation for methyl (1S)-1-hydroxy-2-[(1S,2S)-2-trimethylsilyloxycyclohexyl]oxycyclohex-2-ene-1-carboxylate?
The canonical SMILES for methyl (1S)-1-hydroxy-2-[(1S,2S)-2-trimethylsilyloxycyclohexyl]oxycyclohex-2-ene-1-carboxylate is COC(=O)[C@]1(O)CCCC=C1O[C@H]1CCCC[C@@H]1O[Si](C)(C)C.
What is the InChIKey of methyl (1S)-1-hydroxy-2-[(1S,2S)-2-trimethylsilyloxycyclohexyl]oxycyclohex-2-ene-1-carboxylate?
The InChIKey is WRNMLRIFINSYSY-ZQIUZPCESA-N. The full InChI is InChI=1S/C17H30O5Si/c1-20-16(18)17(19)12-8-7-11-15(17)21-13-9-5-6-10-14(13)22-23(2,3)4/h11,13-14,19H,5-10,12H2,1-4H3/t13-,14-,17-/m0/s1.
What are the key properties of methyl (1S)-1-hydroxy-2-[(1S,2S)-2-trimethylsilyloxycyclohexyl]oxycyclohex-2-ene-1-carboxylate?
methyl (1S)-1-hydroxy-2-[(1S,2S)-2-trimethylsilyloxycyclohexyl]oxycyclohex-2-ene-1-carboxylate has a molecular weight of 342.51 g/mol, XLogP of 3.14, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (1S)-1-hydroxy-2-[(1S,2S)-2-trimethylsilyloxycyclohexyl]oxycyclohex-2-ene-1-carboxylate is sourced from PubChem (CID 14924830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).