About 1-ethyl-4,6-dihydroxy-3-methoxy-4-phenyl-3H-quinolin-2-one
1-ethyl-4,6-dihydroxy-3-methoxy-4-phenyl-3H-quinolin-2-one (PubChem CID 149248585) has the molecular formula C18H19NO4
and a molecular weight of 313.35 g/mol. Its IUPAC name is 1-ethyl-4,6-dihydroxy-3-methoxy-4-phenyl-3H-quinolin-2-one.
Molecular Properties
| Compound Name | 1-ethyl-4,6-dihydroxy-3-methoxy-4-phenyl-3H-quinolin-2-one |
| PubChem CID | 149248585 |
| Molecular Formula | C18H19NO4 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | 1-ethyl-4,6-dihydroxy-3-methoxy-4-phenyl-3H-quinolin-2-one |
| SMILES | CCN1C(=O)C(OC)C(O)(c2ccccc2)c2cc(O)ccc21 |
| InChI | InChI=1S/C18H19NO4/c1-3-19-15-10-9-13(20)11-14(15)18(22,16(23-2)17(19)21)12-7-5-4-6-8-12/h4-11,16,20,22H,3H2,1-2H3 |
| InChIKey | XNPDEFMEHRQWTJ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-ethyl-4,6-dihydroxy-3-methoxy-4-phenyl-3H-quinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-4,6-dihydroxy-3-methoxy-4-phenyl-3H-quinolin-2-one?
The IUPAC name of 1-ethyl-4,6-dihydroxy-3-methoxy-4-phenyl-3H-quinolin-2-one (CID 149248585) is 1-ethyl-4,6-dihydroxy-3-methoxy-4-phenyl-3H-quinolin-2-one.
What is the SMILES notation for 1-ethyl-4,6-dihydroxy-3-methoxy-4-phenyl-3H-quinolin-2-one?
The canonical SMILES for 1-ethyl-4,6-dihydroxy-3-methoxy-4-phenyl-3H-quinolin-2-one is CCN1C(=O)C(OC)C(O)(c2ccccc2)c2cc(O)ccc21.
What is the InChIKey of 1-ethyl-4,6-dihydroxy-3-methoxy-4-phenyl-3H-quinolin-2-one?
The InChIKey is XNPDEFMEHRQWTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19NO4/c1-3-19-15-10-9-13(20)11-14(15)18(22,16(23-2)17(19)21)12-7-5-4-6-8-12/h4-11,16,20,22H,3H2,1-2H3.
What are the key properties of 1-ethyl-4,6-dihydroxy-3-methoxy-4-phenyl-3H-quinolin-2-one?
1-ethyl-4,6-dihydroxy-3-methoxy-4-phenyl-3H-quinolin-2-one has a molecular weight of 313.35 g/mol, XLogP of 2.01, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-4,6-dihydroxy-3-methoxy-4-phenyl-3H-quinolin-2-one is sourced from PubChem (CID 149248585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).