About 1-methyl-7,7a-dihydroindole
1-methyl-7,7a-dihydroindole (PubChem CID 149248869) has the molecular formula C9H11N
and a molecular weight of 133.19 g/mol. Its IUPAC name is 1-methyl-7,7a-dihydroindole.
Molecular Properties
| Compound Name | 1-methyl-7,7a-dihydroindole |
| PubChem CID | 149248869 |
| Molecular Formula | C9H11N |
| Molecular Weight | 133.19 g/mol |
| Exact Mass | 133.09 |
| IUPAC Name | 1-methyl-7,7a-dihydroindole |
| SMILES | CN1C=CC2=CC=CCC21 |
| InChI | InChI=1S/C9H11N/c1-10-7-6-8-4-2-3-5-9(8)10/h2-4,6-7,9H,5H2,1H3 |
| InChIKey | XNQKGMRZIOBKDN-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.19 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-methyl-7,7a-dihydroindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-7,7a-dihydroindole?
The IUPAC name of 1-methyl-7,7a-dihydroindole (CID 149248869) is 1-methyl-7,7a-dihydroindole.
What is the SMILES notation for 1-methyl-7,7a-dihydroindole?
The canonical SMILES for 1-methyl-7,7a-dihydroindole is CN1C=CC2=CC=CCC21.
What is the InChIKey of 1-methyl-7,7a-dihydroindole?
The InChIKey is XNQKGMRZIOBKDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N/c1-10-7-6-8-4-2-3-5-9(8)10/h2-4,6-7,9H,5H2,1H3.
What are the key properties of 1-methyl-7,7a-dihydroindole?
1-methyl-7,7a-dihydroindole has a molecular weight of 133.19 g/mol, XLogP of 1.70, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-7,7a-dihydroindole is sourced from PubChem (CID 149248869), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).