About (1S,2S)-3-methylsulfanylcyclohexa-3,5-diene-1,2-diol
(1S,2S)-3-methylsulfanylcyclohexa-3,5-diene-1,2-diol (PubChem CID 14924919) has the molecular formula C7H10O2S
and a molecular weight of 158.22 g/mol. Its IUPAC name is (1S,2S)-3-methylsulfanylcyclohexa-3,5-diene-1,2-diol.
Analyze (1S,2S)-3-methylsulfanylcyclohexa-3,5-diene-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,2S)-3-methylsulfanylcyclohexa-3,5-diene-1,2-diol?
The IUPAC name of (1S,2S)-3-methylsulfanylcyclohexa-3,5-diene-1,2-diol (CID 14924919) is (1S,2S)-3-methylsulfanylcyclohexa-3,5-diene-1,2-diol.
What is the SMILES notation for (1S,2S)-3-methylsulfanylcyclohexa-3,5-diene-1,2-diol?
The canonical SMILES for (1S,2S)-3-methylsulfanylcyclohexa-3,5-diene-1,2-diol is CSC1=CC=C[C@H](O)[C@@H]1O.
What is the InChIKey of (1S,2S)-3-methylsulfanylcyclohexa-3,5-diene-1,2-diol?
The InChIKey is DBLGHEPWIKOYJW-FSPLSTOPSA-N. The full InChI is InChI=1S/C7H10O2S/c1-10-6-4-2-3-5(8)7(6)9/h2-5,7-9H,1H3/t5-,7-/m0/s1.
What are the key properties of (1S,2S)-3-methylsulfanylcyclohexa-3,5-diene-1,2-diol?
(1S,2S)-3-methylsulfanylcyclohexa-3,5-diene-1,2-diol has a molecular weight of 158.22 g/mol, XLogP of 0.52, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,2S)-3-methylsulfanylcyclohexa-3,5-diene-1,2-diol is sourced from PubChem (CID 14924919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).