About N-cyclohexyl-N',N'-diethyloxamide
N-cyclohexyl-N',N'-diethyloxamide (PubChem CID 14925039) has the molecular formula C12H22N2O2
and a molecular weight of 226.32 g/mol. Its IUPAC name is N-cyclohexyl-N',N'-diethyloxamide.
Molecular Properties
| Compound Name | N-cyclohexyl-N',N'-diethyloxamide |
| PubChem CID | 14925039 |
| Molecular Formula | C12H22N2O2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | N-cyclohexyl-N',N'-diethyloxamide |
| SMILES | CCN(CC)C(=O)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C12H22N2O2/c1-3-14(4-2)12(16)11(15)13-10-8-6-5-7-9-10/h10H,3-9H2,1-2H3,(H,13,15) |
| InChIKey | FNPVKTSHXJVJFH-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-cyclohexyl-N',N'-diethyloxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexyl-N',N'-diethyloxamide?
The IUPAC name of N-cyclohexyl-N',N'-diethyloxamide (CID 14925039) is N-cyclohexyl-N',N'-diethyloxamide.
What is the SMILES notation for N-cyclohexyl-N',N'-diethyloxamide?
The canonical SMILES for N-cyclohexyl-N',N'-diethyloxamide is CCN(CC)C(=O)C(=O)NC1CCCCC1.
What is the InChIKey of N-cyclohexyl-N',N'-diethyloxamide?
The InChIKey is FNPVKTSHXJVJFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2O2/c1-3-14(4-2)12(16)11(15)13-10-8-6-5-7-9-10/h10H,3-9H2,1-2H3,(H,13,15).
What are the key properties of N-cyclohexyl-N',N'-diethyloxamide?
N-cyclohexyl-N',N'-diethyloxamide has a molecular weight of 226.32 g/mol, XLogP of 1.30, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexyl-N',N'-diethyloxamide is sourced from PubChem (CID 14925039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).