C14H26N2O2 — CID 14925041
N-cyclohexyl-N',N'-di(propan-2-yl)oxamide (PubChem CID 14925041) has the molecular formula C14H26N2O2 and a molecular weight of 254.37 g/mol. Its IUPAC name is N-cyclohexyl-N',N'-di(propan-2-yl)oxamide.
| Compound Name | N-cyclohexyl-N',N'-di(propan-2-yl)oxamide |
|---|---|
| PubChem CID | 14925041 |
| Molecular Formula | C14H26N2O2 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.20 |
| IUPAC Name | N-cyclohexyl-N',N'-di(propan-2-yl)oxamide |
| SMILES | CC(C)N(C(=O)C(=O)NC1CCCCC1)C(C)C |
| InChI | InChI=1S/C14H26N2O2/c1-10(2)16(11(3)4)14(18)13(17)15-12-8-6-5-7-9-12/h10-12H,5-9H2,1-4H3,(H,15,17) |
| InChIKey | ZPWLIMLKHGDDLI-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|