About 4-propylimidazol-2-one
4-propylimidazol-2-one (PubChem CID 149250908) has the molecular formula C6H8N2O
and a molecular weight of 124.14 g/mol. Its IUPAC name is 4-propylimidazol-2-one.
Molecular Properties
| Compound Name | 4-propylimidazol-2-one |
| PubChem CID | 149250908 |
| Molecular Formula | C6H8N2O |
| Molecular Weight | 124.14 g/mol |
| Exact Mass | 124.06 |
| IUPAC Name | 4-propylimidazol-2-one |
| SMILES | CCCC1=NC(=O)N=C1 |
| InChI | InChI=1S/C6H8N2O/c1-2-3-5-4-7-6(9)8-5/h4H,2-3H2,1H3 |
| InChIKey | DFLHQCADYYJCDB-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 41.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.14 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-propylimidazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-propylimidazol-2-one?
The IUPAC name of 4-propylimidazol-2-one (CID 149250908) is 4-propylimidazol-2-one.
What is the SMILES notation for 4-propylimidazol-2-one?
The canonical SMILES for 4-propylimidazol-2-one is CCCC1=NC(=O)N=C1.
What is the InChIKey of 4-propylimidazol-2-one?
The InChIKey is DFLHQCADYYJCDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O/c1-2-3-5-4-7-6(9)8-5/h4H,2-3H2,1H3.
What are the key properties of 4-propylimidazol-2-one?
4-propylimidazol-2-one has a molecular weight of 124.14 g/mol, XLogP of 1.43, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-propylimidazol-2-one is sourced from PubChem (CID 149250908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).