About CID 149251233
CID 149251233 (PubChem CID 149251233) has the molecular formula H5NO2SSi
and a molecular weight of 111.20 g/mol.
Molecular Properties
| Compound Name | CID 149251233 |
| PubChem CID | 149251233 |
| Molecular Formula | H5NO2SSi |
| Molecular Weight | 111.20 g/mol |
| Exact Mass | 110.98 |
| IUPAC Name | — |
| SMILES | O=S(O)N[SiH3] |
| InChI | InChI=1S/H5NO2SSi/c2-4(3)1-5/h1H,5H3,(H,2,3) |
| InChIKey | QCIUTWHGGYKPDE-UHFFFAOYSA-N |
| XLogP | -2.01 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 111.20 |
| LogP ≤ 5 | -2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze CID 149251233 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 149251233?
The IUPAC name of CID 149251233 (CID 149251233) is not available.
What is the SMILES notation for CID 149251233?
The canonical SMILES for CID 149251233 is O=S(O)N[SiH3].
What is the InChIKey of CID 149251233?
The InChIKey is QCIUTWHGGYKPDE-UHFFFAOYSA-N. The full InChI is InChI=1S/H5NO2SSi/c2-4(3)1-5/h1H,5H3,(H,2,3).
What are the key properties of CID 149251233?
CID 149251233 has a molecular weight of 111.20 g/mol, XLogP of -2.01, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 149251233 is sourced from PubChem (CID 149251233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).