About CID 149251282
CID 149251282 (PubChem CID 149251282) has the molecular formula H2NO2S3-
and a molecular weight of 144.22 g/mol.
Molecular Properties
| Compound Name | CID 149251282 |
| PubChem CID | 149251282 |
| Molecular Formula | H2NO2S3- |
| Molecular Weight | 144.22 g/mol |
| Exact Mass | 143.93 |
| IUPAC Name | — |
| SMILES | O=S([O-])N(S)S |
| InChI | InChI=1S/H3NO2S3/c2-6(3)1(4)5/h4-5H,(H,2,3)/p-1 |
| InChIKey | GNNNWSNHHFBDEG-UHFFFAOYSA-M |
| XLogP | -0.23 |
| TPSA | 43.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.22 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze CID 149251282 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 149251282?
The IUPAC name of CID 149251282 (CID 149251282) is not available.
What is the SMILES notation for CID 149251282?
The canonical SMILES for CID 149251282 is O=S([O-])N(S)S.
What is the InChIKey of CID 149251282?
The InChIKey is GNNNWSNHHFBDEG-UHFFFAOYSA-M. The full InChI is InChI=1S/H3NO2S3/c2-6(3)1(4)5/h4-5H,(H,2,3)/p-1.
What are the key properties of CID 149251282?
CID 149251282 has a molecular weight of 144.22 g/mol, XLogP of -0.23, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 149251282 is sourced from PubChem (CID 149251282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).