C26H32FN3O2S — CID 149251418
N-[[4-[[[(3aS,9bR)-7-fluoro-1,3,3a,4,5,9b-hexahydrobenzo[e]indol-2-ylidene]amino]methyl]cyclohexyl]methyl]benzenesulfonamide (PubChem CID 149251418) has the molecular formula C26H32FN3O2S and a molecular weight of 469.63 g/mol. Its IUPAC name is N-[[4-[[[(3aS,9bR)-7-fluoro-1,3,3a,4,5,9b-hexahydrobenzo[e]indol-2-ylidene]amino]methyl]cyclohexyl]methyl]benzenesulfonamide.
| Compound Name | N-[[4-[[[(3aS,9bR)-7-fluoro-1,3,3a,4,5,9b-hexahydrobenzo[e]indol-2-ylidene]amino]methyl]cyclohexyl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 149251418 |
| Molecular Formula | C26H32FN3O2S |
| Molecular Weight | 469.63 g/mol |
| Exact Mass | 469.22 |
| IUPAC Name | N-[[4-[[[(3aS,9bR)-7-fluoro-1,3,3a,4,5,9b-hexahydrobenzo[e]indol-2-ylidene]amino]methyl]cyclohexyl]methyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCC1CCC(C/N=C2\C[C@@H]3c4ccc(F)cc4CC[C@@H]3N2)CC1)c1ccccc1 |
| InChI | InChI=1S/C26H32FN3O2S/c27-21-11-12-23-20(14-21)10-13-25-24(23)15-26(30-25)28-16-18-6-8-19(9-7-18)17-29-33(31,32)22-4-2-1-3-5-22/h1-5,11-12,14,18-19,24-25,29H,6-10,13,15-17H2,(H,28,30)/t18?,19?,24-,25+/m1/s1 |
| InChIKey | AIWLUOVMKXITRB-ZTHRNYAASA-N |
| XLogP | 4.40 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.63 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|