C10H17F3N6O — CID 14925798
[[4,6-bis(dimethylamino)-1,3,5-triazin-2-yl]-(2,2,2-trifluoroethyl)amino]methanol (PubChem CID 14925798) has the molecular formula C10H17F3N6O and a molecular weight of 294.28 g/mol. Its IUPAC name is [[4,6-bis(dimethylamino)-1,3,5-triazin-2-yl]-(2,2,2-trifluoroethyl)amino]methanol.
| Compound Name | [[4,6-bis(dimethylamino)-1,3,5-triazin-2-yl]-(2,2,2-trifluoroethyl)amino]methanol |
|---|---|
| PubChem CID | 14925798 |
| Molecular Formula | C10H17F3N6O |
| Molecular Weight | 294.28 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | [[4,6-bis(dimethylamino)-1,3,5-triazin-2-yl]-(2,2,2-trifluoroethyl)amino]methanol |
| SMILES | CN(C)c1nc(N(C)C)nc(N(CO)CC(F)(F)F)n1 |
| InChI | InChI=1S/C10H17F3N6O/c1-17(2)7-14-8(18(3)4)16-9(15-7)19(6-20)5-10(11,12)13/h20H,5-6H2,1-4H3 |
| InChIKey | KLBPFMOKDQRIDH-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.28 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|