C12H24B2O5 — CID 14926002
4,4,5,5-tetramethyl-2-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)oxy]-1,3,2-dioxaborolane (PubChem CID 14926002) has the molecular formula C12H24B2O5 and a molecular weight of 269.94 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)oxy]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)oxy]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 14926002 |
| Molecular Formula | C12H24B2O5 |
| Molecular Weight | 269.94 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)oxy]-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(OB2OC(C)(C)C(C)(C)O2)OC1(C)C |
| InChI | InChI=1S/C12H24B2O5/c1-9(2)10(3,4)16-13(15-9)19-14-17-11(5,6)12(7,8)18-14/h1-8H3 |
| InChIKey | PUFKQRVJYAGFFQ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.94 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|