C24H25F4N3O3 — CID 149260422
1-(6-fluoro-3-pyridinyl)-2-[1-(morpholine-4-carbonyl)-5-[4-(trifluoromethyl)phenyl]piperidin-3-yl]ethanone (PubChem CID 149260422) has the molecular formula C24H25F4N3O3 and a molecular weight of 479.47 g/mol. Its IUPAC name is 1-(6-fluoro-3-pyridinyl)-2-[1-(morpholine-4-carbonyl)-5-[4-(trifluoromethyl)phenyl]piperidin-3-yl]ethanone.
| Compound Name | 1-(6-fluoro-3-pyridinyl)-2-[1-(morpholine-4-carbonyl)-5-[4-(trifluoromethyl)phenyl]piperidin-3-yl]ethanone |
|---|---|
| PubChem CID | 149260422 |
| Molecular Formula | C24H25F4N3O3 |
| Molecular Weight | 479.47 g/mol |
| Exact Mass | 479.18 |
| IUPAC Name | 1-(6-fluoro-3-pyridinyl)-2-[1-(morpholine-4-carbonyl)-5-[4-(trifluoromethyl)phenyl]piperidin-3-yl]ethanone |
| SMILES | O=C(CC1CC(c2ccc(C(F)(F)F)cc2)CN(C(=O)N2CCOCC2)C1)c1ccc(F)nc1 |
| InChI | InChI=1S/C24H25F4N3O3/c25-22-6-3-18(13-29-22)21(32)12-16-11-19(17-1-4-20(5-2-17)24(26,27)28)15-31(14-16)23(33)30-7-9-34-10-8-30/h1-6,13,16,19H,7-12,14-15H2 |
| InChIKey | XPCYGAMEIVRIDN-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.47 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|