C26H40O6 — CID 149260503
decyl 2-[(6S)-2-(hydroxymethyl)-11-oxo-5,7-dioxadispiro[5.1.58.26]pentadeca-9,12-dien-4-yl]acetate (PubChem CID 149260503) has the molecular formula C26H40O6 and a molecular weight of 448.60 g/mol. Its IUPAC name is decyl 2-[(6S)-2-(hydroxymethyl)-11-oxo-5,7-dioxadispiro[5.1.58.26]pentadeca-9,12-dien-4-yl]acetate.
| Compound Name | decyl 2-[(6S)-2-(hydroxymethyl)-11-oxo-5,7-dioxadispiro[5.1.58.26]pentadeca-9,12-dien-4-yl]acetate |
|---|---|
| PubChem CID | 149260503 |
| Molecular Formula | C26H40O6 |
| Molecular Weight | 448.60 g/mol |
| Exact Mass | 448.28 |
| IUPAC Name | decyl 2-[(6S)-2-(hydroxymethyl)-11-oxo-5,7-dioxadispiro[5.1.58.26]pentadeca-9,12-dien-4-yl]acetate |
| SMILES | CCCCCCCCCCOC(=O)CC1CC(CO)C[C@@]2(CCC3(C=CC(=O)C=C3)O2)O1 |
| InChI | InChI=1S/C26H40O6/c1-2-3-4-5-6-7-8-9-16-30-24(29)18-23-17-21(20-27)19-26(31-23)15-14-25(32-26)12-10-22(28)11-13-25/h10-13,21,23,27H,2-9,14-20H2,1H3/t21?,23?,26-/m0/s1 |
| InChIKey | XPDGWTGYYPZWGF-KXUMESBHSA-N |
| XLogP | 4.79 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.60 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|