About 4-[(1,4-dimethyl-3,4-dihydro-2H-pyridin-3-yl)oxy]piperidin-3-amine
4-[(1,4-dimethyl-3,4-dihydro-2H-pyridin-3-yl)oxy]piperidin-3-amine (PubChem CID 149260636) has the molecular formula C12H23N3O
and a molecular weight of 225.34 g/mol. Its IUPAC name is 4-[(1,4-dimethyl-3,4-dihydro-2H-pyridin-3-yl)oxy]piperidin-3-amine.
Molecular Properties
| Compound Name | 4-[(1,4-dimethyl-3,4-dihydro-2H-pyridin-3-yl)oxy]piperidin-3-amine |
| PubChem CID | 149260636 |
| Molecular Formula | C12H23N3O |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.18 |
| IUPAC Name | 4-[(1,4-dimethyl-3,4-dihydro-2H-pyridin-3-yl)oxy]piperidin-3-amine |
| SMILES | CC1C=CN(C)CC1OC1CCNCC1N |
| InChI | InChI=1S/C12H23N3O/c1-9-4-6-15(2)8-12(9)16-11-3-5-14-7-10(11)13/h4,6,9-12,14H,3,5,7-8,13H2,1-2H3 |
| InChIKey | WEZRXQVDEBSOAW-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[(1,4-dimethyl-3,4-dihydro-2H-pyridin-3-yl)oxy]piperidin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(1,4-dimethyl-3,4-dihydro-2H-pyridin-3-yl)oxy]piperidin-3-amine?
The IUPAC name of 4-[(1,4-dimethyl-3,4-dihydro-2H-pyridin-3-yl)oxy]piperidin-3-amine (CID 149260636) is 4-[(1,4-dimethyl-3,4-dihydro-2H-pyridin-3-yl)oxy]piperidin-3-amine.
What is the SMILES notation for 4-[(1,4-dimethyl-3,4-dihydro-2H-pyridin-3-yl)oxy]piperidin-3-amine?
The canonical SMILES for 4-[(1,4-dimethyl-3,4-dihydro-2H-pyridin-3-yl)oxy]piperidin-3-amine is CC1C=CN(C)CC1OC1CCNCC1N.
What is the InChIKey of 4-[(1,4-dimethyl-3,4-dihydro-2H-pyridin-3-yl)oxy]piperidin-3-amine?
The InChIKey is WEZRXQVDEBSOAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23N3O/c1-9-4-6-15(2)8-12(9)16-11-3-5-14-7-10(11)13/h4,6,9-12,14H,3,5,7-8,13H2,1-2H3.
What are the key properties of 4-[(1,4-dimethyl-3,4-dihydro-2H-pyridin-3-yl)oxy]piperidin-3-amine?
4-[(1,4-dimethyl-3,4-dihydro-2H-pyridin-3-yl)oxy]piperidin-3-amine has a molecular weight of 225.34 g/mol, XLogP of 0.16, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1,4-dimethyl-3,4-dihydro-2H-pyridin-3-yl)oxy]piperidin-3-amine is sourced from PubChem (CID 149260636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).