About 5-[5-butyl-2-[[ethyl(dihydroxy)-λ4-sulfanyl]amino]pyrimidin-4-yl]-1,3-dimethylpyridin-2-one
5-[5-butyl-2-[[ethyl(dihydroxy)-λ4-sulfanyl]amino]pyrimidin-4-yl]-1,3-dimethylpyridin-2-one (PubChem CID 149261512) has the molecular formula C17H26N4O3S
and a molecular weight of 366.49 g/mol. Its IUPAC name is 5-[5-butyl-2-[[ethyl(dihydroxy)-λ4-sulfanyl]amino]pyrimidin-4-yl]-1,3-dimethylpyridin-2-one.
Molecular Properties
| Compound Name | 5-[5-butyl-2-[[ethyl(dihydroxy)-λ4-sulfanyl]amino]pyrimidin-4-yl]-1,3-dimethylpyridin-2-one |
| PubChem CID | 149261512 |
| Molecular Formula | C17H26N4O3S |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | 5-[5-butyl-2-[[ethyl(dihydroxy)-λ4-sulfanyl]amino]pyrimidin-4-yl]-1,3-dimethylpyridin-2-one |
| SMILES | CCCCc1cnc(NS(O)(O)CC)nc1-c1cc(C)c(=O)n(C)c1 |
| InChI | InChI=1S/C17H26N4O3S/c1-5-7-8-13-10-18-17(20-25(23,24)6-2)19-15(13)14-9-12(3)16(22)21(4)11-14/h9-11,23-24H,5-8H2,1-4H3,(H,18,19,20) |
| InChIKey | XPIBGJRTSCUEIM-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 100.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 5-[5-butyl-2-[[ethyl(dihydroxy)-λ4-sulfanyl]amino]pyrimidin-4-yl]-1,3-dimethylpyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[5-butyl-2-[[ethyl(dihydroxy)-λ4-sulfanyl]amino]pyrimidin-4-yl]-1,3-dimethylpyridin-2-one?
The IUPAC name of 5-[5-butyl-2-[[ethyl(dihydroxy)-λ4-sulfanyl]amino]pyrimidin-4-yl]-1,3-dimethylpyridin-2-one (CID 149261512) is 5-[5-butyl-2-[[ethyl(dihydroxy)-λ4-sulfanyl]amino]pyrimidin-4-yl]-1,3-dimethylpyridin-2-one.
What is the SMILES notation for 5-[5-butyl-2-[[ethyl(dihydroxy)-λ4-sulfanyl]amino]pyrimidin-4-yl]-1,3-dimethylpyridin-2-one?
The canonical SMILES for 5-[5-butyl-2-[[ethyl(dihydroxy)-λ4-sulfanyl]amino]pyrimidin-4-yl]-1,3-dimethylpyridin-2-one is CCCCc1cnc(NS(O)(O)CC)nc1-c1cc(C)c(=O)n(C)c1.
What is the InChIKey of 5-[5-butyl-2-[[ethyl(dihydroxy)-λ4-sulfanyl]amino]pyrimidin-4-yl]-1,3-dimethylpyridin-2-one?
The InChIKey is XPIBGJRTSCUEIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26N4O3S/c1-5-7-8-13-10-18-17(20-25(23,24)6-2)19-15(13)14-9-12(3)16(22)21(4)11-14/h9-11,23-24H,5-8H2,1-4H3,(H,18,19,20).
What are the key properties of 5-[5-butyl-2-[[ethyl(dihydroxy)-λ4-sulfanyl]amino]pyrimidin-4-yl]-1,3-dimethylpyridin-2-one?
5-[5-butyl-2-[[ethyl(dihydroxy)-λ4-sulfanyl]amino]pyrimidin-4-yl]-1,3-dimethylpyridin-2-one has a molecular weight of 366.49 g/mol, XLogP of 3.59, 7 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[5-butyl-2-[[ethyl(dihydroxy)-λ4-sulfanyl]amino]pyrimidin-4-yl]-1,3-dimethylpyridin-2-one is sourced from PubChem (CID 149261512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).