C14H10F5N — CID 14926284
N-(1,1,2,2,2-pentafluoroethyl)-N-phenylaniline (PubChem CID 14926284) has the molecular formula C14H10F5N and a molecular weight of 287.23 g/mol. Its IUPAC name is N-(1,1,2,2,2-pentafluoroethyl)-N-phenylaniline.
| Compound Name | N-(1,1,2,2,2-pentafluoroethyl)-N-phenylaniline |
|---|---|
| PubChem CID | 14926284 |
| Molecular Formula | C14H10F5N |
| Molecular Weight | 287.23 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | N-(1,1,2,2,2-pentafluoroethyl)-N-phenylaniline |
| SMILES | FC(F)(F)C(F)(F)N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H10F5N/c15-13(16,17)14(18,19)20(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H |
| InChIKey | KKSWINSPJZBBCN-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.23 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|