About 4-methyl-4-phenyl-6H-pyrrolo[1,2-a][4,1]benzoxazepine
4-methyl-4-phenyl-6H-pyrrolo[1,2-a][4,1]benzoxazepine (PubChem CID 14926383) has the molecular formula C19H17NO
and a molecular weight of 275.35 g/mol. Its IUPAC name is 4-methyl-4-phenyl-6H-pyrrolo[1,2-a][4,1]benzoxazepine.
Molecular Properties
| Compound Name | 4-methyl-4-phenyl-6H-pyrrolo[1,2-a][4,1]benzoxazepine |
| PubChem CID | 14926383 |
| Molecular Formula | C19H17NO |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 4-methyl-4-phenyl-6H-pyrrolo[1,2-a][4,1]benzoxazepine |
| SMILES | CC1(c2ccccc2)OCc2ccccc2-n2cccc21 |
| InChI | InChI=1S/C19H17NO/c1-19(16-9-3-2-4-10-16)18-12-7-13-20(18)17-11-6-5-8-15(17)14-21-19/h2-13H,14H2,1H3 |
| InChIKey | NDYSKGYOFFEUGE-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-methyl-4-phenyl-6H-pyrrolo[1,2-a][4,1]benzoxazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-4-phenyl-6H-pyrrolo[1,2-a][4,1]benzoxazepine?
The IUPAC name of 4-methyl-4-phenyl-6H-pyrrolo[1,2-a][4,1]benzoxazepine (CID 14926383) is 4-methyl-4-phenyl-6H-pyrrolo[1,2-a][4,1]benzoxazepine.
What is the SMILES notation for 4-methyl-4-phenyl-6H-pyrrolo[1,2-a][4,1]benzoxazepine?
The canonical SMILES for 4-methyl-4-phenyl-6H-pyrrolo[1,2-a][4,1]benzoxazepine is CC1(c2ccccc2)OCc2ccccc2-n2cccc21.
What is the InChIKey of 4-methyl-4-phenyl-6H-pyrrolo[1,2-a][4,1]benzoxazepine?
The InChIKey is NDYSKGYOFFEUGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17NO/c1-19(16-9-3-2-4-10-16)18-12-7-13-20(18)17-11-6-5-8-15(17)14-21-19/h2-13H,14H2,1H3.
What are the key properties of 4-methyl-4-phenyl-6H-pyrrolo[1,2-a][4,1]benzoxazepine?
4-methyl-4-phenyl-6H-pyrrolo[1,2-a][4,1]benzoxazepine has a molecular weight of 275.35 g/mol, XLogP of 4.27, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-4-phenyl-6H-pyrrolo[1,2-a][4,1]benzoxazepine is sourced from PubChem (CID 14926383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).