C19H18N2 — CID 149264238
3-(2,4-dimethyl-1H-pyrrol-3-yl)-9-methylcarbazole (PubChem CID 149264238) has the molecular formula C19H18N2 and a molecular weight of 274.37 g/mol. Its IUPAC name is 3-(2,4-dimethyl-1H-pyrrol-3-yl)-9-methylcarbazole.
| Compound Name | 3-(2,4-dimethyl-1H-pyrrol-3-yl)-9-methylcarbazole |
|---|---|
| PubChem CID | 149264238 |
| Molecular Formula | C19H18N2 |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | 3-(2,4-dimethyl-1H-pyrrol-3-yl)-9-methylcarbazole |
| SMILES | Cc1c[nH]c(C)c1-c1ccc2c(c1)c1ccccc1n2C |
| InChI | InChI=1S/C19H18N2/c1-12-11-20-13(2)19(12)14-8-9-18-16(10-14)15-6-4-5-7-17(15)21(18)3/h4-11,20H,1-3H3 |
| InChIKey | XPVDKTJAEPVWBR-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |