C6H6Br4 — CID 14926706
(3R,4R,6S)-1,3,4,6-tetrabromocyclohexene (PubChem CID 14926706) has the molecular formula C6H6Br4 and a molecular weight of 397.73 g/mol. Its IUPAC name is (3R,4R,6S)-1,3,4,6-tetrabromocyclohexene.
| Compound Name | (3R,4R,6S)-1,3,4,6-tetrabromocyclohexene |
|---|---|
| PubChem CID | 14926706 |
| Molecular Formula | C6H6Br4 |
| Molecular Weight | 397.73 g/mol |
| Exact Mass | 393.72 |
| IUPAC Name | (3R,4R,6S)-1,3,4,6-tetrabromocyclohexene |
| SMILES | BrC1=C[C@@H](Br)[C@H](Br)C[C@@H]1Br |
| InChI | InChI=1S/C6H6Br4/c7-3-1-4(8)6(10)2-5(3)9/h1,3,5-6H,2H2/t3-,5-,6+/m1/s1 |
| InChIKey | DONXVGWXJLJQCD-PUFIMZNGSA-N |
| XLogP | 3.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.73 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|