methyl (E)-5,5-dimethoxy-3-methylpent-2-enoate

C9H16O4 — CID 14926820

IUPACmethyl (E)-5,5-dimethoxy-3-methylpent-2-enoate
SMILESCOC(=O)/C=C(\C)CC(OC)OC
InChIInChI=1S/C9H16O4/c1-7(5-8(10)11-2)6-9(12-3)13-4/h5,9H,6H2,1-4H3/b7-5+
InChIKeyNJMNOHNAELRDQZ-FNORWQNLSA-N
MW188.22 g/mol
LogP1.11
Rot. Bonds5

About methyl (E)-5,5-dimethoxy-3-methylpent-2-enoate

methyl (E)-5,5-dimethoxy-3-methylpent-2-enoate (PubChem CID 14926820) has the molecular formula C9H16O4 and a molecular weight of 188.22 g/mol. Its IUPAC name is methyl (E)-5,5-dimethoxy-3-methylpent-2-enoate.

Molecular Properties

Compound Namemethyl (E)-5,5-dimethoxy-3-methylpent-2-enoate
PubChem CID14926820
Molecular FormulaC9H16O4
Molecular Weight188.22 g/mol
Exact Mass188.10
IUPAC Namemethyl (E)-5,5-dimethoxy-3-methylpent-2-enoate
SMILESCOC(=O)/C=C(\C)CC(OC)OC
InChIInChI=1S/C9H16O4/c1-7(5-8(10)11-2)6-9(12-3)13-4/h5,9H,6H2,1-4H3/b7-5+
InChIKeyNJMNOHNAELRDQZ-FNORWQNLSA-N
XLogP1.11
TPSA44.76 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500188.22
LogP ≤ 51.11
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze methyl (E)-5,5-dimethoxy-3-methylpent-2-enoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (E)-5,5-dimethoxy-3-methylpent-2-enoate?
The IUPAC name of methyl (E)-5,5-dimethoxy-3-methylpent-2-enoate (CID 14926820) is methyl (E)-5,5-dimethoxy-3-methylpent-2-enoate.
What is the SMILES notation for methyl (E)-5,5-dimethoxy-3-methylpent-2-enoate?
The canonical SMILES for methyl (E)-5,5-dimethoxy-3-methylpent-2-enoate is COC(=O)/C=C(\C)CC(OC)OC.
What is the InChIKey of methyl (E)-5,5-dimethoxy-3-methylpent-2-enoate?
The InChIKey is NJMNOHNAELRDQZ-FNORWQNLSA-N. The full InChI is InChI=1S/C9H16O4/c1-7(5-8(10)11-2)6-9(12-3)13-4/h5,9H,6H2,1-4H3/b7-5+.
What are the key properties of methyl (E)-5,5-dimethoxy-3-methylpent-2-enoate?
methyl (E)-5,5-dimethoxy-3-methylpent-2-enoate has a molecular weight of 188.22 g/mol, XLogP of 1.11, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (E)-5,5-dimethoxy-3-methylpent-2-enoate is sourced from PubChem (CID 14926820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).