C19H33N3O3S2 — CID 149268887
3-[5-(3,3-dihydroxypropylsulfanyl)-1,3-thiazol-2-yl]-1-(3-methylbutyl)-1-(4-methylcyclohexyl)urea (PubChem CID 149268887) has the molecular formula C19H33N3O3S2 and a molecular weight of 415.63 g/mol. Its IUPAC name is 3-[5-(3,3-dihydroxypropylsulfanyl)-1,3-thiazol-2-yl]-1-(3-methylbutyl)-1-(4-methylcyclohexyl)urea.
| Compound Name | 3-[5-(3,3-dihydroxypropylsulfanyl)-1,3-thiazol-2-yl]-1-(3-methylbutyl)-1-(4-methylcyclohexyl)urea |
|---|---|
| PubChem CID | 149268887 |
| Molecular Formula | C19H33N3O3S2 |
| Molecular Weight | 415.63 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | 3-[5-(3,3-dihydroxypropylsulfanyl)-1,3-thiazol-2-yl]-1-(3-methylbutyl)-1-(4-methylcyclohexyl)urea |
| SMILES | CC(C)CCN(C(=O)Nc1ncc(SCCC(O)O)s1)C1CCC(C)CC1 |
| InChI | InChI=1S/C19H33N3O3S2/c1-13(2)8-10-22(15-6-4-14(3)5-7-15)19(25)21-18-20-12-17(27-18)26-11-9-16(23)24/h12-16,23-24H,4-11H2,1-3H3,(H,20,21,25) |
| InChIKey | XQRFRIGWLWURHY-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.63 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|