C14H13N7O2S — CID 149270667
2-[(1,3-diethyl-4-hydroxy-6-oxo-2-sulfanylidenepyrimidin-5-yl)methylideneamino]-1H-imidazole-4,5-dicarbonitrile (PubChem CID 149270667) has the molecular formula C14H13N7O2S and a molecular weight of 343.37 g/mol. Its IUPAC name is 2-[(1,3-diethyl-4-hydroxy-6-oxo-2-sulfanylidenepyrimidin-5-yl)methylideneamino]-1H-imidazole-4,5-dicarbonitrile.
| Compound Name | 2-[(1,3-diethyl-4-hydroxy-6-oxo-2-sulfanylidenepyrimidin-5-yl)methylideneamino]-1H-imidazole-4,5-dicarbonitrile |
|---|---|
| PubChem CID | 149270667 |
| Molecular Formula | C14H13N7O2S |
| Molecular Weight | 343.37 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | 2-[(1,3-diethyl-4-hydroxy-6-oxo-2-sulfanylidenepyrimidin-5-yl)methylideneamino]-1H-imidazole-4,5-dicarbonitrile |
| SMILES | CCn1c(O)c(C=Nc2nc(C#N)c(C#N)[nH]2)c(=O)n(CC)c1=S |
| InChI | InChI=1S/C14H13N7O2S/c1-3-20-11(22)8(12(23)21(4-2)14(20)24)7-17-13-18-9(5-15)10(6-16)19-13/h7,22H,3-4H2,1-2H3,(H,18,19) |
| InChIKey | XRAAKQFREVBZCA-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 135.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.37 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|