C28H38N5O5P — CID 149272240
ditert-butyl [4-(5-methoxy-1-methyl-6,7-dihydroindol-3-yl)-12-methyl-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-5-yl]methyl phosphate (PubChem CID 149272240) has the molecular formula C28H38N5O5P and a molecular weight of 555.62 g/mol. Its IUPAC name is ditert-butyl [4-(5-methoxy-1-methyl-6,7-dihydroindol-3-yl)-12-methyl-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-5-yl]methyl phosphate.
| Compound Name | ditert-butyl [4-(5-methoxy-1-methyl-6,7-dihydroindol-3-yl)-12-methyl-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-5-yl]methyl phosphate |
|---|---|
| PubChem CID | 149272240 |
| Molecular Formula | C28H38N5O5P |
| Molecular Weight | 555.62 g/mol |
| Exact Mass | 555.26 |
| IUPAC Name | ditert-butyl [4-(5-methoxy-1-methyl-6,7-dihydroindol-3-yl)-12-methyl-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-5-yl]methyl phosphate |
| SMILES | COC1=Cc2c(-c3cc4c(ncc5cnc(C)n54)n3COP(=O)(OC(C)(C)C)OC(C)(C)C)cn(C)c2CC1 |
| InChI | InChI=1S/C28H38N5O5P/c1-18-29-14-19-15-30-26-25(33(18)19)13-24(22-16-31(8)23-11-10-20(35-9)12-21(22)23)32(26)17-36-39(34,37-27(2,3)4)38-28(5,6)7/h12-16H,10-11,17H2,1-9H3 |
| InChIKey | XRHNWJJVSGQOCN-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 94.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.62 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|