C30H25N3O4 — CID 149277733
2-(2,3-dihydro-[1,4]dioxino[2,3-b]pyridin-2-ylmethoxy)-9-(4-phenylbut-1-ynyl)-6,7-dihydropyrimido[6,1-a]isoquinolin-4-one (PubChem CID 149277733) has the molecular formula C30H25N3O4 and a molecular weight of 491.55 g/mol. Its IUPAC name is 2-(2,3-dihydro-[1,4]dioxino[2,3-b]pyridin-2-ylmethoxy)-9-(4-phenylbut-1-ynyl)-6,7-dihydropyrimido[6,1-a]isoquinolin-4-one.
| Compound Name | 2-(2,3-dihydro-[1,4]dioxino[2,3-b]pyridin-2-ylmethoxy)-9-(4-phenylbut-1-ynyl)-6,7-dihydropyrimido[6,1-a]isoquinolin-4-one |
|---|---|
| PubChem CID | 149277733 |
| Molecular Formula | C30H25N3O4 |
| Molecular Weight | 491.55 g/mol |
| Exact Mass | 491.18 |
| IUPAC Name | 2-(2,3-dihydro-[1,4]dioxino[2,3-b]pyridin-2-ylmethoxy)-9-(4-phenylbut-1-ynyl)-6,7-dihydropyrimido[6,1-a]isoquinolin-4-one |
| SMILES | O=c1nc(OCC2COc3ncccc3O2)cc2n1CCc1cc(C#CCCc3ccccc3)ccc1-2 |
| InChI | InChI=1S/C30H25N3O4/c34-30-32-28(35-19-24-20-36-29-27(37-24)11-6-15-31-29)18-26-25-13-12-22(17-23(25)14-16-33(26)30)10-5-4-9-21-7-2-1-3-8-21/h1-3,6-8,11-13,15,17-18,24H,4,9,14,16,19-20H2 |
| InChIKey | XSIQJTCMSMPZKT-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 75.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.55 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|