C11H19BO2 — CID 14927829
5,5-dimethyl-2-[(1E)-4-methylpenta-1,3-dienyl]-1,3,2-dioxaborinane (PubChem CID 14927829) has the molecular formula C11H19BO2 and a molecular weight of 194.08 g/mol. Its IUPAC name is 5,5-dimethyl-2-[(1E)-4-methylpenta-1,3-dienyl]-1,3,2-dioxaborinane.
| Compound Name | 5,5-dimethyl-2-[(1E)-4-methylpenta-1,3-dienyl]-1,3,2-dioxaborinane |
|---|---|
| PubChem CID | 14927829 |
| Molecular Formula | C11H19BO2 |
| Molecular Weight | 194.08 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | 5,5-dimethyl-2-[(1E)-4-methylpenta-1,3-dienyl]-1,3,2-dioxaborinane |
| SMILES | CC(C)=C/C=C/B1OCC(C)(C)CO1 |
| InChI | InChI=1S/C11H19BO2/c1-10(2)6-5-7-12-13-8-11(3,4)9-14-12/h5-7H,8-9H2,1-4H3/b7-5+ |
| InChIKey | YYXMYEGMKXCSQP-FNORWQNLSA-N |
| XLogP | 2.61 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.08 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|