C15H11Cl3N6 — CID 1492807
6-imino-1-phenyl-3-N-(2,4,6-trichlorophenyl)-1,2,4-triazine-3,5-diamine (PubChem CID 1492807) has the molecular formula C15H11Cl3N6 and a molecular weight of 381.65 g/mol. Its IUPAC name is 6-imino-1-phenyl-3-N-(2,4,6-trichlorophenyl)-1,2,4-triazine-3,5-diamine.
| Compound Name | 6-imino-1-phenyl-3-N-(2,4,6-trichlorophenyl)-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 1492807 |
| Molecular Formula | C15H11Cl3N6 |
| Molecular Weight | 381.65 g/mol |
| Exact Mass | 380.01 |
| IUPAC Name | 6-imino-1-phenyl-3-N-(2,4,6-trichlorophenyl)-1,2,4-triazine-3,5-diamine |
| SMILES | [H]/N=c1\c(N)nc(Nc2c(Cl)cc(Cl)cc2Cl)nn1-c1ccccc1 |
| InChI | InChI=1S/C15H11Cl3N6/c16-8-6-10(17)12(11(18)7-8)21-15-22-13(19)14(20)24(23-15)9-4-2-1-3-5-9/h1-7,20H,(H3,19,21,22,23)/b20-14+ |
| InChIKey | ALIBFAANFLSFIC-XSFVSMFZSA-N |
| XLogP | 4.03 |
| TPSA | 92.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.65 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'} |
|---|