C5H5F8NO3S — CID 14928166
1,1,2,2-tetrafluoro-N-methyl-2-(1,1,2,2-tetrafluoroethoxy)ethanesulfonamide (PubChem CID 14928166) has the molecular formula C5H5F8NO3S and a molecular weight of 311.15 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-N-methyl-2-(1,1,2,2-tetrafluoroethoxy)ethanesulfonamide.
| Compound Name | 1,1,2,2-tetrafluoro-N-methyl-2-(1,1,2,2-tetrafluoroethoxy)ethanesulfonamide |
|---|---|
| PubChem CID | 14928166 |
| Molecular Formula | C5H5F8NO3S |
| Molecular Weight | 311.15 g/mol |
| Exact Mass | 310.99 |
| IUPAC Name | 1,1,2,2-tetrafluoro-N-methyl-2-(1,1,2,2-tetrafluoroethoxy)ethanesulfonamide |
| SMILES | CNS(=O)(=O)C(F)(F)C(F)(F)OC(F)(F)C(F)F |
| InChI | InChI=1S/C5H5F8NO3S/c1-14-18(15,16)5(12,13)4(10,11)17-3(8,9)2(6)7/h2,14H,1H3 |
| InChIKey | GARAZBZLGDLXHL-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.15 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|