C5H4ClF8NO3S — CID 14928168
2-(2-chloro-1,1,2,2-tetrafluoroethoxy)-1,1,2,2-tetrafluoro-N-methylethanesulfonamide (PubChem CID 14928168) has the molecular formula C5H4ClF8NO3S and a molecular weight of 345.60 g/mol. Its IUPAC name is 2-(2-chloro-1,1,2,2-tetrafluoroethoxy)-1,1,2,2-tetrafluoro-N-methylethanesulfonamide.
| Compound Name | 2-(2-chloro-1,1,2,2-tetrafluoroethoxy)-1,1,2,2-tetrafluoro-N-methylethanesulfonamide |
|---|---|
| PubChem CID | 14928168 |
| Molecular Formula | C5H4ClF8NO3S |
| Molecular Weight | 345.60 g/mol |
| Exact Mass | 344.95 |
| IUPAC Name | 2-(2-chloro-1,1,2,2-tetrafluoroethoxy)-1,1,2,2-tetrafluoro-N-methylethanesulfonamide |
| SMILES | CNS(=O)(=O)C(F)(F)C(F)(F)OC(F)(F)C(F)(F)Cl |
| InChI | InChI=1S/C5H4ClF8NO3S/c1-15-19(16,17)5(13,14)4(11,12)18-3(9,10)2(6,7)8/h15H,1H3 |
| InChIKey | QREZMMJKPUPVHT-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.60 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|