About 4,7-di(propan-2-yl)-1,2,3-benzothiadiselenole
4,7-di(propan-2-yl)-1,2,3-benzothiadiselenole (PubChem CID 14928235) has the molecular formula C12H16SSe2
and a molecular weight of 350.25 g/mol. Its IUPAC name is 4,7-di(propan-2-yl)-1,2,3-benzothiadiselenole.
Molecular Properties
| Compound Name | 4,7-di(propan-2-yl)-1,2,3-benzothiadiselenole |
| PubChem CID | 14928235 |
| Molecular Formula | C12H16SSe2 |
| Molecular Weight | 350.25 g/mol |
| Exact Mass | 351.93 |
| IUPAC Name | 4,7-di(propan-2-yl)-1,2,3-benzothiadiselenole |
| SMILES | CC(C)c1ccc(C(C)C)c2c1S[Se][Se]2 |
| InChI | InChI=1S/C12H16SSe2/c1-7(2)9-5-6-10(8(3)4)12-11(9)13-15-14-12/h5-8H,1-4H3 |
| InChIKey | CXUQAMQCPPZRHV-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.25 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 4,7-di(propan-2-yl)-1,2,3-benzothiadiselenole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,7-di(propan-2-yl)-1,2,3-benzothiadiselenole?
The IUPAC name of 4,7-di(propan-2-yl)-1,2,3-benzothiadiselenole (CID 14928235) is 4,7-di(propan-2-yl)-1,2,3-benzothiadiselenole.
What is the SMILES notation for 4,7-di(propan-2-yl)-1,2,3-benzothiadiselenole?
The canonical SMILES for 4,7-di(propan-2-yl)-1,2,3-benzothiadiselenole is CC(C)c1ccc(C(C)C)c2c1S[Se][Se]2.
What is the InChIKey of 4,7-di(propan-2-yl)-1,2,3-benzothiadiselenole?
The InChIKey is CXUQAMQCPPZRHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16SSe2/c1-7(2)9-5-6-10(8(3)4)12-11(9)13-15-14-12/h5-8H,1-4H3.
What are the key properties of 4,7-di(propan-2-yl)-1,2,3-benzothiadiselenole?
4,7-di(propan-2-yl)-1,2,3-benzothiadiselenole has a molecular weight of 350.25 g/mol, XLogP of 2.90, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,7-di(propan-2-yl)-1,2,3-benzothiadiselenole is sourced from PubChem (CID 14928235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).