About 5-amino-3-(3-chloro-2-methylanilino)-1-methyl-1,2,4-triazin-6-one
5-amino-3-(3-chloro-2-methylanilino)-1-methyl-1,2,4-triazin-6-one (PubChem CID 1492850) has the molecular formula C11H12ClN5O
and a molecular weight of 265.70 g/mol. Its IUPAC name is 5-amino-3-(3-chloro-2-methylanilino)-1-methyl-1,2,4-triazin-6-one.
Molecular Properties
| Compound Name | 5-amino-3-(3-chloro-2-methylanilino)-1-methyl-1,2,4-triazin-6-one |
| PubChem CID | 1492850 |
| Molecular Formula | C11H12ClN5O |
| Molecular Weight | 265.70 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | 5-amino-3-(3-chloro-2-methylanilino)-1-methyl-1,2,4-triazin-6-one |
| SMILES | Cc1c(Cl)cccc1Nc1nc(N)c(=O)n(C)n1 |
| InChI | InChI=1S/C11H12ClN5O/c1-6-7(12)4-3-5-8(6)14-11-15-9(13)10(18)17(2)16-11/h3-5H,1-2H3,(H3,13,14,15,16) |
| InChIKey | PGMFQADVBFOFRK-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.70 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-amino-3-(3-chloro-2-methylanilino)-1-methyl-1,2,4-triazin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-3-(3-chloro-2-methylanilino)-1-methyl-1,2,4-triazin-6-one?
The IUPAC name of 5-amino-3-(3-chloro-2-methylanilino)-1-methyl-1,2,4-triazin-6-one (CID 1492850) is 5-amino-3-(3-chloro-2-methylanilino)-1-methyl-1,2,4-triazin-6-one.
What is the SMILES notation for 5-amino-3-(3-chloro-2-methylanilino)-1-methyl-1,2,4-triazin-6-one?
The canonical SMILES for 5-amino-3-(3-chloro-2-methylanilino)-1-methyl-1,2,4-triazin-6-one is Cc1c(Cl)cccc1Nc1nc(N)c(=O)n(C)n1.
What is the InChIKey of 5-amino-3-(3-chloro-2-methylanilino)-1-methyl-1,2,4-triazin-6-one?
The InChIKey is PGMFQADVBFOFRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12ClN5O/c1-6-7(12)4-3-5-8(6)14-11-15-9(13)10(18)17(2)16-11/h3-5H,1-2H3,(H3,13,14,15,16).
What are the key properties of 5-amino-3-(3-chloro-2-methylanilino)-1-methyl-1,2,4-triazin-6-one?
5-amino-3-(3-chloro-2-methylanilino)-1-methyl-1,2,4-triazin-6-one has a molecular weight of 265.70 g/mol, XLogP of 1.46, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-3-(3-chloro-2-methylanilino)-1-methyl-1,2,4-triazin-6-one is sourced from PubChem (CID 1492850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).