C10H13FO4S — CID 14929164
(1-fluoro-2,2-dimethoxyethyl)sulfonylbenzene (PubChem CID 14929164) has the molecular formula C10H13FO4S and a molecular weight of 248.28 g/mol. Its IUPAC name is (1-fluoro-2,2-dimethoxyethyl)sulfonylbenzene.
| Compound Name | (1-fluoro-2,2-dimethoxyethyl)sulfonylbenzene |
|---|---|
| PubChem CID | 14929164 |
| Molecular Formula | C10H13FO4S |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.05 |
| IUPAC Name | (1-fluoro-2,2-dimethoxyethyl)sulfonylbenzene |
| SMILES | COC(OC)C(F)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C10H13FO4S/c1-14-10(15-2)9(11)16(12,13)8-6-4-3-5-7-8/h3-7,9-10H,1-2H3 |
| InChIKey | GUCGWHBVOCGOPA-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|